About 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid
2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid (PubChem CID 5221819) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid |
| PubChem CID | 5221819 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid |
| SMILES | O=C(O)Cc1nc(C2CCCC2)cs1 |
| InChI | InChI=1S/C10H13NO2S/c12-10(13)5-9-11-8(6-14-9)7-3-1-2-4-7/h6-7H,1-5H2,(H,12,13) |
| InChIKey | BAZUOQRHUNLPEN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid?
The IUPAC name of 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid (CID 5221819) is 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid.
What is the SMILES notation for 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid?
The canonical SMILES for 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid is O=C(O)Cc1nc(C2CCCC2)cs1.
What is the InChIKey of 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid?
The InChIKey is BAZUOQRHUNLPEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c12-10(13)5-9-11-8(6-14-9)7-3-1-2-4-7/h6-7H,1-5H2,(H,12,13).
What are the key properties of 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid?
2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid has a molecular weight of 211.29 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclopentyl-1,3-thiazol-2-yl)acetic acid is sourced from PubChem (CID 5221819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).