C10H15NO2 — CID 5222842
5,8,8-trimethyl-6-azabicyclo[3.2.1]octane-4,7-dione (PubChem CID 5222842) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 5,8,8-trimethyl-6-azabicyclo[3.2.1]octane-4,7-dione.
| Compound Name | 5,8,8-trimethyl-6-azabicyclo[3.2.1]octane-4,7-dione |
|---|---|
| PubChem CID | 5222842 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 5,8,8-trimethyl-6-azabicyclo[3.2.1]octane-4,7-dione |
| SMILES | CC12NC(=O)C(CCC1=O)C2(C)C |
| InChI | InChI=1S/C10H15NO2/c1-9(2)6-4-5-7(12)10(9,3)11-8(6)13/h6H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | IJVVJJPJJAOLKI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |