C14H16N2O — CID 5222864
1,1,3,3-tetramethylfuro[3,4-b][1,6]naphthyridine (PubChem CID 5222864) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,1,3,3-tetramethylfuro[3,4-b][1,6]naphthyridine.
| Compound Name | 1,1,3,3-tetramethylfuro[3,4-b][1,6]naphthyridine |
|---|---|
| PubChem CID | 5222864 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1,1,3,3-tetramethylfuro[3,4-b][1,6]naphthyridine |
| SMILES | CC1(C)OC(C)(C)c2nc3ccncc3cc21 |
| InChI | InChI=1S/C14H16N2O/c1-13(2)10-7-9-8-15-6-5-11(9)16-12(10)14(3,4)17-13/h5-8H,1-4H3 |
| InChIKey | LGWXZUARIPJWCQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |