C8H4F3N3O6 — CID 5222967
2,2,2-trifluoro-N-(2-hydroxy-3,5-dinitrophenyl)acetamide (PubChem CID 5222967) has the molecular formula C8H4F3N3O6 and a molecular weight of 295.13 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-hydroxy-3,5-dinitrophenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-hydroxy-3,5-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 5222967 |
| Molecular Formula | C8H4F3N3O6 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-hydroxy-3,5-dinitrophenyl)acetamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)C(F)(F)F |
| InChI | InChI=1S/C8H4F3N3O6/c9-8(10,11)7(16)12-4-1-3(13(17)18)2-5(6(4)15)14(19)20/h1-2,15H,(H,12,16) |
| InChIKey | CXBXTIXTTDTIBS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|