C28H30N2O4S — CID 5223275
[3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] adamantane-1-carboxylate (PubChem CID 5223275) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] adamantane-1-carboxylate.
| Compound Name | [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 5223275 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | [3-methyl-4-(4-methylphenyl)sulfonyl-1-phenylpyrazol-5-yl] adamantane-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nn(-c3ccccc3)c2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C28H30N2O4S/c1-18-8-10-24(11-9-18)35(32,33)25-19(2)29-30(23-6-4-3-5-7-23)26(25)34-27(31)28-15-20-12-21(16-28)14-22(13-20)17-28/h3-11,20-22H,12-17H2,1-2H3 |
| InChIKey | HFEMDUWAWGSKNM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |