C22H20N6O3S — CID 5224317
2-(4-tert-butyl-1,3-thiazol-2-yl)-4-[(2-nitrophenyl)diazenyl]-5-phenyl-1H-pyrazol-3-one (PubChem CID 5224317) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-4-[(2-nitrophenyl)diazenyl]-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-4-[(2-nitrophenyl)diazenyl]-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 5224317 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-4-[(2-nitrophenyl)diazenyl]-5-phenyl-1H-pyrazol-3-one |
| SMILES | CC(C)(C)c1csc(-n2[nH]c(-c3ccccc3)c(/N=N/c3ccccc3[N+](=O)[O-])c2=O)n1 |
| InChI | InChI=1S/C22H20N6O3S/c1-22(2,3)17-13-32-21(23-17)27-20(29)19(18(26-27)14-9-5-4-6-10-14)25-24-15-11-7-8-12-16(15)28(30)31/h4-13,26H,1-3H3/b25-24+ |
| InChIKey | IXCDMXBECIRJNR-OCOZRVBESA-N |
| XLogP | 5.91 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|