C28H29N3O5 — CID 5224331
N-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide (PubChem CID 5224331) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5224331 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-bis(4-methoxyphenyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCc3ccc(OC)c(OC)c3)n(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C28H29N3O5/c1-33-22-10-6-20(7-11-22)24-18-25(31(30-24)21-8-12-23(34-2)13-9-21)28(32)29-16-15-19-5-14-26(35-3)27(17-19)36-4/h5-14,17-18H,15-16H2,1-4H3,(H,29,32) |
| InChIKey | DQQXYSURGVBMMI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |