C22H21NO2 — CID 5224761
4-(2-methyl-3-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzoic acid (PubChem CID 5224761) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-(2-methyl-3-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzoic acid.
| Compound Name | 4-(2-methyl-3-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 5224761 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-(2-methyl-3-phenyl-4,5,6,7-tetrahydroindol-1-yl)benzoic acid |
| SMILES | Cc1c(-c2ccccc2)c2c(n1-c1ccc(C(=O)O)cc1)CCCC2 |
| InChI | InChI=1S/C22H21NO2/c1-15-21(16-7-3-2-4-8-16)19-9-5-6-10-20(19)23(15)18-13-11-17(12-14-18)22(24)25/h2-4,7-8,11-14H,5-6,9-10H2,1H3,(H,24,25) |
| InChIKey | IOEKAVMWSGEKJM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |