About 3,5-dimethylcyclopentene
3,5-dimethylcyclopentene (PubChem CID 522549) has the molecular formula C7H12
and a molecular weight of 96.17 g/mol. Its IUPAC name is 3,5-dimethylcyclopentene.
Molecular Properties
| Compound Name | 3,5-dimethylcyclopentene |
| PubChem CID | 522549 |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | 3,5-dimethylcyclopentene |
| SMILES | CC1C=CC(C)C1 |
| InChI | InChI=1S/C7H12/c1-6-3-4-7(2)5-6/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | PUPAPFTXLYVYPX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethylcyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylcyclopentene?
The IUPAC name of 3,5-dimethylcyclopentene (CID 522549) is 3,5-dimethylcyclopentene.
What is the SMILES notation for 3,5-dimethylcyclopentene?
The canonical SMILES for 3,5-dimethylcyclopentene is CC1C=CC(C)C1.
What is the InChIKey of 3,5-dimethylcyclopentene?
The InChIKey is PUPAPFTXLYVYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12/c1-6-3-4-7(2)5-6/h3-4,6-7H,5H2,1-2H3.
What are the key properties of 3,5-dimethylcyclopentene?
3,5-dimethylcyclopentene has a molecular weight of 96.17 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylcyclopentene is sourced from PubChem (CID 522549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).