About 1-aminoethanol
1-aminoethanol (PubChem CID 522583) has the molecular formula C2H7NO
and a molecular weight of 61.08 g/mol. Its IUPAC name is 1-aminoethanol.
Molecular Properties
| Compound Name | 1-aminoethanol |
| PubChem CID | 522583 |
| Molecular Formula | C2H7NO |
| Molecular Weight | 61.08 g/mol |
| Exact Mass | 61.05 |
| IUPAC Name | 1-aminoethanol |
| SMILES | CC(N)O |
| InChI | InChI=1S/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| InChIKey | UJPKMTDFFUTLGM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 61.08 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethanol?
The IUPAC name of 1-aminoethanol (CID 522583) is 1-aminoethanol.
What is the SMILES notation for 1-aminoethanol?
The canonical SMILES for 1-aminoethanol is CC(N)O.
What is the InChIKey of 1-aminoethanol?
The InChIKey is UJPKMTDFFUTLGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3.
What are the key properties of 1-aminoethanol?
1-aminoethanol has a molecular weight of 61.08 g/mol, XLogP of -0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethanol is sourced from PubChem (CID 522583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).