About 1-Ethyladamantane
1-Ethyladamantane (PubChem CID 522637) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 1-ethyladamantane.
Molecular Properties
| Compound Name | 1-Ethyladamantane |
| PubChem CID | 522637 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 1-ethyladamantane |
| SMILES | CCC12CC3CC(C1)CC(C3)C2 |
| InChI | InChI=1S/C12H20/c1-2-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,2-8H2,1H3 |
| InChIKey | LXTHCCWEYOKFSR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 151 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-Ethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Ethyladamantane?
The IUPAC name of 1-Ethyladamantane (CID 522637) is 1-ethyladamantane.
What is the SMILES notation for 1-Ethyladamantane?
The canonical SMILES for 1-Ethyladamantane is CCC12CC3CC(C1)CC(C3)C2.
What is the InChIKey of 1-Ethyladamantane?
The InChIKey is LXTHCCWEYOKFSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-2-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,2-8H2,1H3.
What are the key properties of 1-Ethyladamantane?
1-Ethyladamantane has a molecular weight of 164.29 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Ethyladamantane is sourced from PubChem (CID 522637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).