About N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide
N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide (PubChem CID 5226375) has the molecular formula C14H16N2O2S
and a molecular weight of 276.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
| PubChem CID | 5226375 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
| SMILES | COCCNC(=O)c1ccc(-c2csc(C)n2)cc1 |
| InChI | InChI=1S/C14H16N2O2S/c1-10-16-13(9-19-10)11-3-5-12(6-4-11)14(17)15-7-8-18-2/h3-6,9H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | OXRKOCOWIIHNJO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide?
The IUPAC name of N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide (CID 5226375) is N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide.
What is the SMILES notation for N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide?
The canonical SMILES for N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide is COCCNC(=O)c1ccc(-c2csc(C)n2)cc1.
What is the InChIKey of N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide?
The InChIKey is OXRKOCOWIIHNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c1-10-16-13(9-19-10)11-3-5-12(6-4-11)14(17)15-7-8-18-2/h3-6,9H,7-8H2,1-2H3,(H,15,17).
What are the key properties of N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide?
N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide has a molecular weight of 276.36 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide is sourced from PubChem (CID 5226375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).