About 1-triphenylsilylethanone
1-triphenylsilylethanone (PubChem CID 5226386) has the molecular formula C20H18OSi
and a molecular weight of 302.45 g/mol. Its IUPAC name is 1-triphenylsilylethanone.
Molecular Properties
| Compound Name | 1-triphenylsilylethanone |
| PubChem CID | 5226386 |
| Molecular Formula | C20H18OSi |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-triphenylsilylethanone |
| SMILES | CC(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18OSi/c1-17(21)22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3 |
| InChIKey | GVJSGABMOHZNSD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-triphenylsilylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-triphenylsilylethanone?
The IUPAC name of 1-triphenylsilylethanone (CID 5226386) is 1-triphenylsilylethanone.
What is the SMILES notation for 1-triphenylsilylethanone?
The canonical SMILES for 1-triphenylsilylethanone is CC(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-triphenylsilylethanone?
The InChIKey is GVJSGABMOHZNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18OSi/c1-17(21)22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3.
What are the key properties of 1-triphenylsilylethanone?
1-triphenylsilylethanone has a molecular weight of 302.45 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-triphenylsilylethanone is sourced from PubChem (CID 5226386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).