C29H31N3O3 — CID 5226530
5-[[4-(1-adamantyl)phenyl]iminomethyl]-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 5226530) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 5-[[4-(1-adamantyl)phenyl]iminomethyl]-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[[4-(1-adamantyl)phenyl]iminomethyl]-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5226530 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 5-[[4-(1-adamantyl)phenyl]iminomethyl]-1-(3,4-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)c(=O)[nH]c2=O)cc1C |
| InChI | InChI=1S/C29H31N3O3/c1-17-3-8-24(9-18(17)2)32-27(34)25(26(33)31-28(32)35)16-30-23-6-4-22(5-7-23)29-13-19-10-20(14-29)12-21(11-19)15-29/h3-9,16,19-21,34H,10-15H2,1-2H3,(H,31,33,35)/b30-16+ |
| InChIKey | HZIWHABXDMNNQF-OKCVXOCRSA-N |
| XLogP | 5.07 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|