About 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide (PubChem CID 5226770) has the molecular formula C11H12N4O2S
and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide |
| PubChem CID | 5226770 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide |
| SMILES | CCc1nnc(SCC(=O)Nc2ccccn2)o1 |
| InChI | InChI=1S/C11H12N4O2S/c1-2-10-14-15-11(17-10)18-7-9(16)13-8-5-3-4-6-12-8/h3-6H,2,7H2,1H3,(H,12,13,16) |
| InChIKey | YXEKJILAPDCJHG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide?
The IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide (CID 5226770) is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide.
What is the SMILES notation for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide?
The canonical SMILES for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide is CCc1nnc(SCC(=O)Nc2ccccn2)o1.
What is the InChIKey of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide?
The InChIKey is YXEKJILAPDCJHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2S/c1-2-10-14-15-11(17-10)18-7-9(16)13-8-5-3-4-6-12-8/h3-6H,2,7H2,1H3,(H,12,13,16).
What are the key properties of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide?
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide has a molecular weight of 264.31 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-pyridin-2-ylacetamide is sourced from PubChem (CID 5226770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).