About 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one
1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one (PubChem CID 522742) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one.
Analyze 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one?
The IUPAC name of 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one (CID 522742) is 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one.
What is the SMILES notation for 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one?
The canonical SMILES for 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one is CCC(=O)C1=CCCCN1.
What is the InChIKey of 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one?
The InChIKey is DOGZYNACXGUDFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-2-8(10)7-5-3-4-6-9-7/h5,9H,2-4,6H2,1H3.
What are the key properties of 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one?
1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one has a molecular weight of 139.20 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,3,4-tetrahydropyridin-6-yl)propan-1-one is sourced from PubChem (CID 522742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).