C13H19N3O3S — CID 5227429
5-oxo-N-(3-propan-2-yloxypropyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 5227429) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-oxo-N-(3-propan-2-yloxypropyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | 5-oxo-N-(3-propan-2-yloxypropyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 5227429 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-oxo-N-(3-propan-2-yloxypropyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1cnc2n(c1=O)CCS2 |
| InChI | InChI=1S/C13H19N3O3S/c1-9(2)19-6-3-4-14-11(17)10-8-15-13-16(12(10)18)5-7-20-13/h8-9H,3-7H2,1-2H3,(H,14,17) |
| InChIKey | NTTFNDLZNPFNJN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|