C11H13N3O3S — CID 5227526
S-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]] N,N-diethylcarbamothioate (PubChem CID 5227526) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is S-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]] N,N-diethylcarbamothioate.
| Compound Name | S-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]] N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 5227526 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | S-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]] N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)Sc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C11H13N3O3S/c1-3-14(4-2)11(15)18-10-13-12-9(17-10)8-6-5-7-16-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | OFJQDEJYBAOXRN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|