C21H10F10Si — CID 5227669
methyl-bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethenyl)silane (PubChem CID 5227669) has the molecular formula C21H10F10Si and a molecular weight of 480.38 g/mol. Its IUPAC name is methyl-bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethenyl)silane.
| Compound Name | methyl-bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethenyl)silane |
|---|---|
| PubChem CID | 5227669 |
| Molecular Formula | C21H10F10Si |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | methyl-bis(2,3,4,5,6-pentafluorophenyl)-(2-phenylethenyl)silane |
| SMILES | C[Si](C=Cc1ccccc1)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H10F10Si/c1-32(8-7-9-5-3-2-4-6-9,20-16(28)12(24)10(22)13(25)17(20)29)21-18(30)14(26)11(23)15(27)19(21)31/h2-8H,1H3 |
| InChIKey | LSEKWRXKEDQDOH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|