About trimethylsilyl cyclopentanecarboxylate
trimethylsilyl cyclopentanecarboxylate (PubChem CID 522818) has the molecular formula C9H18O2Si
and a molecular weight of 186.33 g/mol. Its IUPAC name is trimethylsilyl cyclopentanecarboxylate.
Molecular Properties
| Compound Name | trimethylsilyl cyclopentanecarboxylate |
| PubChem CID | 522818 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | trimethylsilyl cyclopentanecarboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1CCCC1 |
| InChI | InChI=1S/C9H18O2Si/c1-12(2,3)11-9(10)8-6-4-5-7-8/h8H,4-7H2,1-3H3 |
| InChIKey | RCNLUVBAZAMEIC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl cyclopentanecarboxylate?
The IUPAC name of trimethylsilyl cyclopentanecarboxylate (CID 522818) is trimethylsilyl cyclopentanecarboxylate.
What is the SMILES notation for trimethylsilyl cyclopentanecarboxylate?
The canonical SMILES for trimethylsilyl cyclopentanecarboxylate is C[Si](C)(C)OC(=O)C1CCCC1.
What is the InChIKey of trimethylsilyl cyclopentanecarboxylate?
The InChIKey is RCNLUVBAZAMEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2Si/c1-12(2,3)11-9(10)8-6-4-5-7-8/h8H,4-7H2,1-3H3.
What are the key properties of trimethylsilyl cyclopentanecarboxylate?
trimethylsilyl cyclopentanecarboxylate has a molecular weight of 186.33 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl cyclopentanecarboxylate is sourced from PubChem (CID 522818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).