C34H23N5O6 — CID 5228227
5-[(6-hydroxy-1-naphthalen-1-yl-2,4-dioxopyrimidin-5-yl)-pyridin-4-ylmethyl]-1-naphthalen-1-yl-1,3-diazinane-2,4,6-trione (PubChem CID 5228227) has the molecular formula C34H23N5O6 and a molecular weight of 597.59 g/mol. Its IUPAC name is 5-[(6-hydroxy-1-naphthalen-1-yl-2,4-dioxopyrimidin-5-yl)-pyridin-4-ylmethyl]-1-naphthalen-1-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(6-hydroxy-1-naphthalen-1-yl-2,4-dioxopyrimidin-5-yl)-pyridin-4-ylmethyl]-1-naphthalen-1-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5228227 |
| Molecular Formula | C34H23N5O6 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | 5-[(6-hydroxy-1-naphthalen-1-yl-2,4-dioxopyrimidin-5-yl)-pyridin-4-ylmethyl]-1-naphthalen-1-yl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc3ccccc23)C(=O)C1C(c1ccncc1)c1c(O)n(-c2cccc3ccccc23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H23N5O6/c40-29-27(31(42)38(33(44)36-29)24-13-5-9-19-7-1-3-11-22(19)24)26(21-15-17-35-18-16-21)28-30(41)37-34(45)39(32(28)43)25-14-6-10-20-8-2-4-12-23(20)25/h1-18,26-27,43H,(H,36,40,44)(H,37,41,45) |
| InChIKey | PNAFNHBYZYBCCC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|