About 1-butyl-2,6-dimethylpyridine-4-thione
1-butyl-2,6-dimethylpyridine-4-thione (PubChem CID 5228475) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is 1-butyl-2,6-dimethylpyridine-4-thione.
Molecular Properties
| Compound Name | 1-butyl-2,6-dimethylpyridine-4-thione |
| PubChem CID | 5228475 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-butyl-2,6-dimethylpyridine-4-thione |
| SMILES | CCCCn1c(C)cc(=S)cc1C |
| InChI | InChI=1S/C11H17NS/c1-4-5-6-12-9(2)7-11(13)8-10(12)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | KIZNJTXHGHPBJE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2,6-dimethylpyridine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,6-dimethylpyridine-4-thione?
The IUPAC name of 1-butyl-2,6-dimethylpyridine-4-thione (CID 5228475) is 1-butyl-2,6-dimethylpyridine-4-thione.
What is the SMILES notation for 1-butyl-2,6-dimethylpyridine-4-thione?
The canonical SMILES for 1-butyl-2,6-dimethylpyridine-4-thione is CCCCn1c(C)cc(=S)cc1C.
What is the InChIKey of 1-butyl-2,6-dimethylpyridine-4-thione?
The InChIKey is KIZNJTXHGHPBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS/c1-4-5-6-12-9(2)7-11(13)8-10(12)3/h7-8H,4-6H2,1-3H3.
What are the key properties of 1-butyl-2,6-dimethylpyridine-4-thione?
1-butyl-2,6-dimethylpyridine-4-thione has a molecular weight of 195.33 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,6-dimethylpyridine-4-thione is sourced from PubChem (CID 5228475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).