About N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide
N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide (PubChem CID 5228602) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide |
| PubChem CID | 5228602 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide |
| SMILES | CCN(CC)C(=O)C1C(=O)C2CCC1C(C)(C)C2 |
| InChI | InChI=1S/C15H25NO2/c1-5-16(6-2)14(18)12-11-8-7-10(13(12)17)9-15(11,3)4/h10-12H,5-9H2,1-4H3 |
| InChIKey | UGTUJKWPKKDMCM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide?
The IUPAC name of N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide (CID 5228602) is N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide.
What is the SMILES notation for N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide?
The canonical SMILES for N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide is CCN(CC)C(=O)C1C(=O)C2CCC1C(C)(C)C2.
What is the InChIKey of N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide?
The InChIKey is UGTUJKWPKKDMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2/c1-5-16(6-2)14(18)12-11-8-7-10(13(12)17)9-15(11,3)4/h10-12H,5-9H2,1-4H3.
What are the key properties of N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide?
N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide has a molecular weight of 251.37 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-6,6-dimethyl-3-oxobicyclo[2.2.2]octane-2-carboxamide is sourced from PubChem (CID 5228602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).