About 3,4-diethylphenol
3,4-diethylphenol (PubChem CID 522880) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,4-diethylphenol.
Molecular Properties
| Compound Name | 3,4-diethylphenol |
| PubChem CID | 522880 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3,4-diethylphenol |
| SMILES | CCc1ccc(O)cc1CC |
| InChI | InChI=1S/C10H14O/c1-3-8-5-6-10(11)7-9(8)4-2/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | SEAZSNZFNABEMJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-diethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylphenol?
The IUPAC name of 3,4-diethylphenol (CID 522880) is 3,4-diethylphenol.
What is the SMILES notation for 3,4-diethylphenol?
The canonical SMILES for 3,4-diethylphenol is CCc1ccc(O)cc1CC.
What is the InChIKey of 3,4-diethylphenol?
The InChIKey is SEAZSNZFNABEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-3-8-5-6-10(11)7-9(8)4-2/h5-7,11H,3-4H2,1-2H3.
What are the key properties of 3,4-diethylphenol?
3,4-diethylphenol has a molecular weight of 150.22 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylphenol is sourced from PubChem (CID 522880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).