About propyl 2-hydroxyacetate
propyl 2-hydroxyacetate (PubChem CID 522946) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is propyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | propyl 2-hydroxyacetate |
| PubChem CID | 522946 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | propyl 2-hydroxyacetate |
| SMILES | CCCOC(=O)CO |
| InChI | InChI=1S/C5H10O3/c1-2-3-8-5(7)4-6/h6H,2-4H2,1H3 |
| InChIKey | NORCOOJYTVHQCR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-hydroxyacetate?
The IUPAC name of propyl 2-hydroxyacetate (CID 522946) is propyl 2-hydroxyacetate.
What is the SMILES notation for propyl 2-hydroxyacetate?
The canonical SMILES for propyl 2-hydroxyacetate is CCCOC(=O)CO.
What is the InChIKey of propyl 2-hydroxyacetate?
The InChIKey is NORCOOJYTVHQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c1-2-3-8-5(7)4-6/h6H,2-4H2,1H3.
What are the key properties of propyl 2-hydroxyacetate?
propyl 2-hydroxyacetate has a molecular weight of 118.13 g/mol, XLogP of -0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-hydroxyacetate is sourced from PubChem (CID 522946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).