C18H13N6S2- — CID 5229727
3-carbamothioyl-3,5-dicyano-2,4-dipyridin-3-yl-2,4-dihydro-1H-pyridine-6-thiolate (PubChem CID 5229727) has the molecular formula C18H13N6S2- and a molecular weight of 377.48 g/mol. Its IUPAC name is 3-carbamothioyl-3,5-dicyano-2,4-dipyridin-3-yl-2,4-dihydro-1H-pyridine-6-thiolate.
| Compound Name | 3-carbamothioyl-3,5-dicyano-2,4-dipyridin-3-yl-2,4-dihydro-1H-pyridine-6-thiolate |
|---|---|
| PubChem CID | 5229727 |
| Molecular Formula | C18H13N6S2- |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-carbamothioyl-3,5-dicyano-2,4-dipyridin-3-yl-2,4-dihydro-1H-pyridine-6-thiolate |
| SMILES | N#CC1=C([S-])NC(c2cccnc2)C(C#N)(C(N)=S)C1c1cccnc1 |
| InChI | InChI=1S/C18H14N6S2/c19-7-13-14(11-3-1-5-22-8-11)18(10-20,17(21)26)15(24-16(13)25)12-4-2-6-23-9-12/h1-6,8-9,14-15,24-25H,(H2,21,26)/p-1 |
| InChIKey | OBBLUHIVXCKYME-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|