C20H21N3O3S2 — CID 5229923
ethyl 4-[(3-cyano-6-methyl-4-thiophen-2-yl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)sulfanyl]-3-oxobutanoate (PubChem CID 5229923) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is ethyl 4-[(3-cyano-6-methyl-4-thiophen-2-yl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 4-[(3-cyano-6-methyl-4-thiophen-2-yl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 5229923 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | ethyl 4-[(3-cyano-6-methyl-4-thiophen-2-yl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1nc2c(c(-c3cccs3)c1C#N)CN(C)CC2 |
| InChI | InChI=1S/C20H21N3O3S2/c1-3-26-18(25)9-13(24)12-28-20-14(10-21)19(17-5-4-8-27-17)15-11-23(2)7-6-16(15)22-20/h4-5,8H,3,6-7,9,11-12H2,1-2H3 |
| InChIKey | KTYNFPIPGYQTFP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|