C19H13ClN4O2 — CID 5230675
2-amino-4-(2-chloro-5-nitrophenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile (PubChem CID 5230675) has the molecular formula C19H13ClN4O2 and a molecular weight of 364.79 g/mol. Its IUPAC name is 2-amino-4-(2-chloro-5-nitrophenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(2-chloro-5-nitrophenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5230675 |
| Molecular Formula | C19H13ClN4O2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-amino-4-(2-chloro-5-nitrophenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccccc1-c1cc(-c2cc([N+](=O)[O-])ccc2Cl)c(C#N)c(N)n1 |
| InChI | InChI=1S/C19H13ClN4O2/c1-11-4-2-3-5-13(11)18-9-14(16(10-21)19(22)23-18)15-8-12(24(25)26)6-7-17(15)20/h2-9H,1H3,(H2,22,23) |
| InChIKey | OVHWLZLINQPEDZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|