About 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide
4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide (PubChem CID 5230750) has the molecular formula C20H20N3O+
and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide.
Molecular Properties
| Compound Name | 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide |
| PubChem CID | 5230750 |
| Molecular Formula | C20H20N3O+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide |
| SMILES | CN(C)c1cc[n+](C(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N3O/c1-21(2)17-13-15-22(16-14-17)20(24)23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16H,1-2H3/q+1 |
| InChIKey | RBRWMBJMVCKQMO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide?
The IUPAC name of 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide (CID 5230750) is 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide.
What is the SMILES notation for 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide?
The canonical SMILES for 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide is CN(C)c1cc[n+](C(=O)N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide?
The InChIKey is RBRWMBJMVCKQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N3O/c1-21(2)17-13-15-22(16-14-17)20(24)23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16H,1-2H3/q+1.
What are the key properties of 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide?
4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide has a molecular weight of 318.40 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-N,N-diphenylpyridin-1-ium-1-carboxamide is sourced from PubChem (CID 5230750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).