C25H29N3O5 — CID 5230890
ethyl 6-acetyl-2-(4-butoxyphenyl)-3-carbamoyl-1-cyano-3,8a-dihydro-2H-indolizine-1-carboxylate (PubChem CID 5230890) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is ethyl 6-acetyl-2-(4-butoxyphenyl)-3-carbamoyl-1-cyano-3,8a-dihydro-2H-indolizine-1-carboxylate.
| Compound Name | ethyl 6-acetyl-2-(4-butoxyphenyl)-3-carbamoyl-1-cyano-3,8a-dihydro-2H-indolizine-1-carboxylate |
|---|---|
| PubChem CID | 5230890 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | ethyl 6-acetyl-2-(4-butoxyphenyl)-3-carbamoyl-1-cyano-3,8a-dihydro-2H-indolizine-1-carboxylate |
| SMILES | CCCCOc1ccc(C2C(C(N)=O)N3C=C(C(C)=O)C=CC3C2(C#N)C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H29N3O5/c1-4-6-13-33-19-10-7-17(8-11-19)21-22(23(27)30)28-14-18(16(3)29)9-12-20(28)25(21,15-26)24(31)32-5-2/h7-12,14,20-22H,4-6,13H2,1-3H3,(H2,27,30) |
| InChIKey | GRVPBHMFVAERDE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|