C13H17F6N — CID 5231211
5-(trifluoromethyl)-2-[3-(trifluoromethyl)cyclohexyl]-1,2,3,6-tetrahydropyridine (PubChem CID 5231211) has the molecular formula C13H17F6N and a molecular weight of 301.27 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-[3-(trifluoromethyl)cyclohexyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(trifluoromethyl)-2-[3-(trifluoromethyl)cyclohexyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 5231211 |
| Molecular Formula | C13H17F6N |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5-(trifluoromethyl)-2-[3-(trifluoromethyl)cyclohexyl]-1,2,3,6-tetrahydropyridine |
| SMILES | FC(F)(F)C1=CCC(C2CCCC(C(F)(F)F)C2)NC1 |
| InChI | InChI=1S/C13H17F6N/c14-12(15,16)9-3-1-2-8(6-9)11-5-4-10(7-20-11)13(17,18)19/h4,8-9,11,20H,1-3,5-7H2 |
| InChIKey | FKLIYKHTOGUARR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|