About acetylazanium
acetylazanium (PubChem CID 5231230) has the molecular formula C2H6NO+
and a molecular weight of 60.08 g/mol. Its IUPAC name is acetylazanium.
Molecular Properties
| Compound Name | acetylazanium |
| PubChem CID | 5231230 |
| Molecular Formula | C2H6NO+ |
| Molecular Weight | 60.08 g/mol |
| Exact Mass | 60.04 |
| IUPAC Name | acetylazanium |
| SMILES | CC([NH3+])=O |
| InChI | InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/p+1 |
| InChIKey | DLFVBJFMPXGRIB-UHFFFAOYSA-O |
| XLogP | -1.23 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 60.08 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylazanium?
The IUPAC name of acetylazanium (CID 5231230) is acetylazanium.
What is the SMILES notation for acetylazanium?
The canonical SMILES for acetylazanium is CC([NH3+])=O.
What is the InChIKey of acetylazanium?
The InChIKey is DLFVBJFMPXGRIB-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/p+1.
What are the key properties of acetylazanium?
acetylazanium has a molecular weight of 60.08 g/mol, XLogP of -1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylazanium is sourced from PubChem (CID 5231230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).