About N'-hydroxy-N,N-dimethylethanimidamide
N'-hydroxy-N,N-dimethylethanimidamide (PubChem CID 5231234) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is N'-hydroxy-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-N,N-dimethylethanimidamide |
| PubChem CID | 5231234 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | N'-hydroxy-N,N-dimethylethanimidamide |
| SMILES | CC(=NO)N(C)C |
| InChI | InChI=1S/C4H10N2O/c1-4(5-7)6(2)3/h7H,1-3H3 |
| InChIKey | FGSWVUVISMIKSR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-N,N-dimethylethanimidamide?
The IUPAC name of N'-hydroxy-N,N-dimethylethanimidamide (CID 5231234) is N'-hydroxy-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-hydroxy-N,N-dimethylethanimidamide?
The canonical SMILES for N'-hydroxy-N,N-dimethylethanimidamide is CC(=NO)N(C)C.
What is the InChIKey of N'-hydroxy-N,N-dimethylethanimidamide?
The InChIKey is FGSWVUVISMIKSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-4(5-7)6(2)3/h7H,1-3H3.
What are the key properties of N'-hydroxy-N,N-dimethylethanimidamide?
N'-hydroxy-N,N-dimethylethanimidamide has a molecular weight of 102.14 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-N,N-dimethylethanimidamide is sourced from PubChem (CID 5231234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).