C7H2F9N3 — CID 5231254
4-fluoro-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 5231254) has the molecular formula C7H2F9N3 and a molecular weight of 299.10 g/mol. Its IUPAC name is 4-fluoro-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-fluoro-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 5231254 |
| Molecular Formula | C7H2F9N3 |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 4-fluoro-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Nc1nc(F)c(C(F)(F)F)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H2F9N3/c8-3-1(6(11,12)13)2(18-4(17)19-3)5(9,10)7(14,15)16/h(H2,17,18,19) |
| InChIKey | BHSPKKMJRHLZTO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|