C33H50O7 — CID 5231323
[8-(1-acetyloxyethyl)-3,5b,8,11a,13a-pentamethyl-1-oxo-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydro-3H-phenanthro[2,1-e][2]benzofuran-13-yl] 3-hydroxybutanoate (PubChem CID 5231323) has the molecular formula C33H50O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is [8-(1-acetyloxyethyl)-3,5b,8,11a,13a-pentamethyl-1-oxo-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydro-3H-phenanthro[2,1-e][2]benzofuran-13-yl] 3-hydroxybutanoate.
| Compound Name | [8-(1-acetyloxyethyl)-3,5b,8,11a,13a-pentamethyl-1-oxo-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydro-3H-phenanthro[2,1-e][2]benzofuran-13-yl] 3-hydroxybutanoate |
|---|---|
| PubChem CID | 5231323 |
| Molecular Formula | C33H50O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | [8-(1-acetyloxyethyl)-3,5b,8,11a,13a-pentamethyl-1-oxo-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydro-3H-phenanthro[2,1-e][2]benzofuran-13-yl] 3-hydroxybutanoate |
| SMILES | CC(=O)OC(C)C1(C)CCCC2(C)C1CCC1(C)C2CC(OC(=O)CC(C)O)C2(C)C3=C(CCC12)C(C)OC3=O |
| InChI | InChI=1S/C33H50O7/c1-18(34)16-27(36)40-26-17-25-31(6)14-9-13-30(5,20(3)39-21(4)35)23(31)12-15-32(25,7)24-11-10-22-19(2)38-29(37)28(22)33(24,26)8/h18-20,23-26,34H,9-17H2,1-8H3 |
| InChIKey | CCSDAFQOJRPGKA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|