About 1,2-dihydroquinoline
1,2-dihydroquinoline (PubChem CID 5231402) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 1,2-dihydroquinoline.
Molecular Properties
| Compound Name | 1,2-dihydroquinoline |
| PubChem CID | 5231402 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 1,2-dihydroquinoline |
| SMILES | C1=Cc2ccccc2NC1 |
| InChI | InChI=1S/C9H9N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-6,10H,7H2 |
| InChIKey | IRFSXVIRXMYULF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroquinoline?
The IUPAC name of 1,2-dihydroquinoline (CID 5231402) is 1,2-dihydroquinoline.
What is the SMILES notation for 1,2-dihydroquinoline?
The canonical SMILES for 1,2-dihydroquinoline is C1=Cc2ccccc2NC1.
What is the InChIKey of 1,2-dihydroquinoline?
The InChIKey is IRFSXVIRXMYULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-6,10H,7H2.
What are the key properties of 1,2-dihydroquinoline?
1,2-dihydroquinoline has a molecular weight of 131.18 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroquinoline is sourced from PubChem (CID 5231402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).