About 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine
4-piperidin-4-yl-1,2,3,6-tetrahydropyridine (PubChem CID 5231471) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine.
Molecular Properties
| Compound Name | 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine |
| PubChem CID | 5231471 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(C2CCNCC2)CCNC1 |
| InChI | InChI=1S/C10H18N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1,10-12H,2-8H2 |
| InChIKey | VLJPTOSWVGRETM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine?
The IUPAC name of 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine (CID 5231471) is 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine.
What is the SMILES notation for 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine?
The canonical SMILES for 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine is C1=C(C2CCNCC2)CCNC1.
What is the InChIKey of 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine?
The InChIKey is VLJPTOSWVGRETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1,10-12H,2-8H2.
What are the key properties of 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine?
4-piperidin-4-yl-1,2,3,6-tetrahydropyridine has a molecular weight of 166.27 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-4-yl-1,2,3,6-tetrahydropyridine is sourced from PubChem (CID 5231471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).