About N-methyl-1,2-dihydropyridine-5-carboxamide
N-methyl-1,2-dihydropyridine-5-carboxamide (PubChem CID 5231518) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is N-methyl-1,2-dihydropyridine-5-carboxamide.
Molecular Properties
| Compound Name | N-methyl-1,2-dihydropyridine-5-carboxamide |
| PubChem CID | 5231518 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | N-methyl-1,2-dihydropyridine-5-carboxamide |
| SMILES | CNC(=O)C1=CNCC=C1 |
| InChI | InChI=1S/C7H10N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-3,5,9H,4H2,1H3,(H,8,10) |
| InChIKey | XLSBOYLWETVJCY-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1,2-dihydropyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,2-dihydropyridine-5-carboxamide?
The IUPAC name of N-methyl-1,2-dihydropyridine-5-carboxamide (CID 5231518) is N-methyl-1,2-dihydropyridine-5-carboxamide.
What is the SMILES notation for N-methyl-1,2-dihydropyridine-5-carboxamide?
The canonical SMILES for N-methyl-1,2-dihydropyridine-5-carboxamide is CNC(=O)C1=CNCC=C1.
What is the InChIKey of N-methyl-1,2-dihydropyridine-5-carboxamide?
The InChIKey is XLSBOYLWETVJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-3,5,9H,4H2,1H3,(H,8,10).
What are the key properties of N-methyl-1,2-dihydropyridine-5-carboxamide?
N-methyl-1,2-dihydropyridine-5-carboxamide has a molecular weight of 138.17 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,2-dihydropyridine-5-carboxamide is sourced from PubChem (CID 5231518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).