About ethoxymethanediol
ethoxymethanediol (PubChem CID 5231668) has the molecular formula C3H8O3
and a molecular weight of 92.09 g/mol. Its IUPAC name is ethoxymethanediol.
Molecular Properties
| Compound Name | ethoxymethanediol |
| PubChem CID | 5231668 |
| Molecular Formula | C3H8O3 |
| Molecular Weight | 92.09 g/mol |
| Exact Mass | 92.05 |
| IUPAC Name | ethoxymethanediol |
| SMILES | CCOC(O)O |
| InChI | InChI=1S/C3H8O3/c1-2-6-3(4)5/h3-5H,2H2,1H3 |
| InChIKey | FGCLOJOLJQDQOG-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.09 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxymethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethanediol?
The IUPAC name of ethoxymethanediol (CID 5231668) is ethoxymethanediol.
What is the SMILES notation for ethoxymethanediol?
The canonical SMILES for ethoxymethanediol is CCOC(O)O.
What is the InChIKey of ethoxymethanediol?
The InChIKey is FGCLOJOLJQDQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3/c1-2-6-3(4)5/h3-5H,2H2,1H3.
What are the key properties of ethoxymethanediol?
ethoxymethanediol has a molecular weight of 92.09 g/mol, XLogP of -0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethanediol is sourced from PubChem (CID 5231668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).