About 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol
3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 5231829) has the molecular formula C8H12O3S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 5231829 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | CS(=O)CC1=CC=CC(O)C1O |
| InChI | InChI=1S/C8H12O3S/c1-12(11)5-6-3-2-4-7(9)8(6)10/h2-4,7-10H,5H2,1H3 |
| InChIKey | UXSHCBCGSYWBSA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol (CID 5231829) is 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol is CS(=O)CC1=CC=CC(O)C1O.
What is the InChIKey of 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol?
The InChIKey is UXSHCBCGSYWBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3S/c1-12(11)5-6-3-2-4-7(9)8(6)10/h2-4,7-10H,5H2,1H3.
What are the key properties of 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol?
3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol has a molecular weight of 188.25 g/mol, XLogP of -0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylsulfinylmethyl)cyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 5231829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).