About 1,2,4-trimethylcyclopentene
1,2,4-trimethylcyclopentene (PubChem CID 523224) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is 1,2,4-trimethylcyclopentene.
Molecular Properties
| Compound Name | 1,2,4-trimethylcyclopentene |
| PubChem CID | 523224 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | 1,2,4-trimethylcyclopentene |
| SMILES | CC1=C(C)CC(C)C1 |
| InChI | InChI=1S/C8H14/c1-6-4-7(2)8(3)5-6/h6H,4-5H2,1-3H3 |
| InChIKey | MSNOKIKTRNYOPS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4-trimethylcyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trimethylcyclopentene?
The IUPAC name of 1,2,4-trimethylcyclopentene (CID 523224) is 1,2,4-trimethylcyclopentene.
What is the SMILES notation for 1,2,4-trimethylcyclopentene?
The canonical SMILES for 1,2,4-trimethylcyclopentene is CC1=C(C)CC(C)C1.
What is the InChIKey of 1,2,4-trimethylcyclopentene?
The InChIKey is MSNOKIKTRNYOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14/c1-6-4-7(2)8(3)5-6/h6H,4-5H2,1-3H3.
What are the key properties of 1,2,4-trimethylcyclopentene?
1,2,4-trimethylcyclopentene has a molecular weight of 110.20 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trimethylcyclopentene is sourced from PubChem (CID 523224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).