About S-(4-ethynylphenyl) ethanethioate
S-(4-ethynylphenyl) ethanethioate (PubChem CID 5232571) has the molecular formula C10H8OS
and a molecular weight of 176.24 g/mol. Its IUPAC name is S-(4-ethynylphenyl) ethanethioate.
Molecular Properties
| Compound Name | S-(4-ethynylphenyl) ethanethioate |
| PubChem CID | 5232571 |
| Molecular Formula | C10H8OS |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | S-(4-ethynylphenyl) ethanethioate |
| SMILES | C#Cc1ccc(SC(C)=O)cc1 |
| InChI | InChI=1S/C10H8OS/c1-3-9-4-6-10(7-5-9)12-8(2)11/h1,4-7H,2H3 |
| InChIKey | SUKCGDCKAJESMC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-(4-ethynylphenyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-ethynylphenyl) ethanethioate?
The IUPAC name of S-(4-ethynylphenyl) ethanethioate (CID 5232571) is S-(4-ethynylphenyl) ethanethioate.
What is the SMILES notation for S-(4-ethynylphenyl) ethanethioate?
The canonical SMILES for S-(4-ethynylphenyl) ethanethioate is C#Cc1ccc(SC(C)=O)cc1.
What is the InChIKey of S-(4-ethynylphenyl) ethanethioate?
The InChIKey is SUKCGDCKAJESMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8OS/c1-3-9-4-6-10(7-5-9)12-8(2)11/h1,4-7H,2H3.
What are the key properties of S-(4-ethynylphenyl) ethanethioate?
S-(4-ethynylphenyl) ethanethioate has a molecular weight of 176.24 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-ethynylphenyl) ethanethioate is sourced from PubChem (CID 5232571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).