C48H42O12 — CID 5232762
ethyl 2-[2-[2,4,6-tris(acetyloxymethyl)-3,5-bis[2-(2-ethoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate (PubChem CID 5232762) has the molecular formula C48H42O12 and a molecular weight of 810.85 g/mol. Its IUPAC name is ethyl 2-[2-[2,4,6-tris(acetyloxymethyl)-3,5-bis[2-(2-ethoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate.
| Compound Name | ethyl 2-[2-[2,4,6-tris(acetyloxymethyl)-3,5-bis[2-(2-ethoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 5232762 |
| Molecular Formula | C48H42O12 |
| Molecular Weight | 810.85 g/mol |
| Exact Mass | 810.27 |
| IUPAC Name | ethyl 2-[2-[2,4,6-tris(acetyloxymethyl)-3,5-bis[2-(2-ethoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1C#Cc1c(COC(C)=O)c(C#Cc2ccccc2C(=O)OCC)c(COC(C)=O)c(C#Cc2ccccc2C(=O)OCC)c1COC(C)=O |
| InChI | InChI=1S/C48H42O12/c1-7-55-46(52)37-19-13-10-16-34(37)22-25-40-43(28-58-31(4)49)41(26-23-35-17-11-14-20-38(35)47(53)56-8-2)45(30-60-33(6)51)42(44(40)29-59-32(5)50)27-24-36-18-12-15-21-39(36)48(54)57-9-3/h10-21H,7-9,28-30H2,1-6H3 |
| InChIKey | HJQDBCVTMAPZTR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.85 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|