About 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine
2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine (PubChem CID 5232770) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine |
| PubChem CID | 5232770 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine |
| SMILES | C1=CNC(C2NCCCN2)N=C1 |
| InChI | InChI=1S/C8H14N4/c1-3-9-7(10-4-1)8-11-5-2-6-12-8/h1,3-4,7-9,11-12H,2,5-6H2 |
| InChIKey | ZUSKGRZPEUPYIM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine?
The IUPAC name of 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine (CID 5232770) is 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine.
What is the SMILES notation for 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine?
The canonical SMILES for 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine is C1=CNC(C2NCCCN2)N=C1.
What is the InChIKey of 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine?
The InChIKey is ZUSKGRZPEUPYIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-3-9-7(10-4-1)8-11-5-2-6-12-8/h1,3-4,7-9,11-12H,2,5-6H2.
What are the key properties of 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine?
2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine has a molecular weight of 166.23 g/mol, XLogP of -0.59, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-diazinan-2-yl)-1,2-dihydropyrimidine is sourced from PubChem (CID 5232770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).