C46H39BF15N2- — CID 5232937
2,3-bis[[2,6-di(propan-2-yl)phenyl]imino]butyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 5232937) has the molecular formula C46H39BF15N2- and a molecular weight of 915.61 g/mol. Its IUPAC name is 2,3-bis[[2,6-di(propan-2-yl)phenyl]imino]butyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2,3-bis[[2,6-di(propan-2-yl)phenyl]imino]butyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 5232937 |
| Molecular Formula | C46H39BF15N2- |
| Molecular Weight | 915.61 g/mol |
| Exact Mass | 915.30 |
| IUPAC Name | 2,3-bis[[2,6-di(propan-2-yl)phenyl]imino]butyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(=N\c1c(C(C)C)cccc1C(C)C)/C(C[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)=N\c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C46H39BF15N2/c1-17(2)22-12-10-13-23(18(3)4)45(22)63-21(9)26(64-46-24(19(5)6)14-11-15-25(46)20(7)8)16-47(27-30(48)36(54)42(60)37(55)31(27)49,28-32(50)38(56)43(61)39(57)33(28)51)29-34(52)40(58)44(62)41(59)35(29)53/h10-15,17-20H,16H2,1-9H3/q-1/b63-21+,64-26- |
| InChIKey | XKQVOZYFQONZRS-WSDNREFSSA-N |
| XLogP | 13.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.61 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|