About N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine
N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine (PubChem CID 5233032) has the molecular formula C9H10Cl2N3+
and a molecular weight of 231.11 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine |
| PubChem CID | 5233032 |
| Molecular Formula | C9H10Cl2N3+ |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine |
| SMILES | Clc1cccc(Cl)c1NC1=[NH+]CCN1 |
| InChI | InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14)/p+1 |
| InChIKey | GJSURZIOUXUGAL-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine?
The IUPAC name of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine (CID 5233032) is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine.
What is the SMILES notation for N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine?
The canonical SMILES for N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine is Clc1cccc(Cl)c1NC1=[NH+]CCN1.
What is the InChIKey of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine?
The InChIKey is GJSURZIOUXUGAL-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14)/p+1.
What are the key properties of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine?
N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine has a molecular weight of 231.11 g/mol, XLogP of 0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-3-ium-2-amine is sourced from PubChem (CID 5233032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).