About 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol
4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol (PubChem CID 5233037) has the molecular formula C21H19N3O
and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol |
| PubChem CID | 5233037 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol |
| SMILES | Cc1ccccc1Nc1c(-c2ccc(O)cc2)nc2c(C)cccn12 |
| InChI | InChI=1S/C21H19N3O/c1-14-6-3-4-8-18(14)22-21-19(16-9-11-17(25)12-10-16)23-20-15(2)7-5-13-24(20)21/h3-13,22,25H,1-2H3 |
| InChIKey | QIYPLGBZYZVPDK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol?
The IUPAC name of 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol (CID 5233037) is 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol.
What is the SMILES notation for 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol?
The canonical SMILES for 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol is Cc1ccccc1Nc1c(-c2ccc(O)cc2)nc2c(C)cccn12.
What is the InChIKey of 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol?
The InChIKey is QIYPLGBZYZVPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O/c1-14-6-3-4-8-18(14)22-21-19(16-9-11-17(25)12-10-16)23-20-15(2)7-5-13-24(20)21/h3-13,22,25H,1-2H3.
What are the key properties of 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol?
4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol has a molecular weight of 329.40 g/mol, XLogP of 5.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[8-methyl-3-(2-methylanilino)imidazo[1,2-a]pyridin-2-yl]phenol is sourced from PubChem (CID 5233037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).