C16H12F2N2 — CID 5233210
4-(2,4-difluorophenyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 5233210) has the molecular formula C16H12F2N2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | 4-(2,4-difluorophenyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 5233210 |
| Molecular Formula | C16H12F2N2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-(2,4-difluorophenyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | Fc1ccc(-c2cc3n(c2)CCn2cccc2-3)c(F)c1 |
| InChI | InChI=1S/C16H12F2N2/c17-12-3-4-13(14(18)9-12)11-8-16-15-2-1-5-19(15)6-7-20(16)10-11/h1-5,8-10H,6-7H2 |
| InChIKey | XVSNHRLMGMSGEE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |