C13H10F10N4O2S2 — CID 5233395
N,N'-bis(4,5-dihydro-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6-decafluoroheptanediamide (PubChem CID 5233395) has the molecular formula C13H10F10N4O2S2 and a molecular weight of 508.36 g/mol. Its IUPAC name is N,N'-bis(4,5-dihydro-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6-decafluoroheptanediamide.
| Compound Name | N,N'-bis(4,5-dihydro-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6-decafluoroheptanediamide |
|---|---|
| PubChem CID | 5233395 |
| Molecular Formula | C13H10F10N4O2S2 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | N,N'-bis(4,5-dihydro-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6-decafluoroheptanediamide |
| SMILES | O=C(NC1=NCCS1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C13H10F10N4O2S2/c14-9(15,5(28)26-7-24-1-3-30-7)11(18,19)13(22,23)12(20,21)10(16,17)6(29)27-8-25-2-4-31-8/h1-4H2,(H,24,26,28)(H,25,27,29) |
| InChIKey | QCEKMIPETYPYFS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|