C21H52O6Si5 — CID 523378
trimethylsilyl (2S,3R,4R,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate (PubChem CID 523378) has the molecular formula C21H52O6Si5 and a molecular weight of 541.07 g/mol. Its IUPAC name is trimethylsilyl (2S,3R,4R,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate.
| Compound Name | trimethylsilyl (2S,3R,4R,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate |
|---|---|
| PubChem CID | 523378 |
| Molecular Formula | C21H52O6Si5 |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | trimethylsilyl (2S,3R,4R,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate |
| SMILES | C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H52O6Si5/c1-17(23-28(2,3)4)18(24-29(5,6)7)19(25-30(8,9)10)20(26-31(11,12)13)21(22)27-32(14,15)16/h17-20H,1-16H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | GJYJHENJLCOPHY-NMLBUPMWSA-N |
| XLogP | 6.26 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|